C14H20O3 — CID 102280153
methyl (3aS,7aS)-2,5,5-trimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate (PubChem CID 102280153) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (3aS,7aS)-2,5,5-trimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate.
| Compound Name | methyl (3aS,7aS)-2,5,5-trimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 102280153 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (3aS,7aS)-2,5,5-trimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(C)=C[C@@H]1CCC(C)(C)C2=O |
| InChI | InChI=1S/C14H20O3/c1-9-7-10-5-6-13(2,3)11(15)14(10,8-9)12(16)17-4/h7,10H,5-6,8H2,1-4H3/t10-,14-/m0/s1 |
| InChIKey | OIADECZYHCKCMC-HZMBPMFUSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|