C30H38O4Si — CID 102280155
methyl (3aS,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-dimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate (PubChem CID 102280155) has the molecular formula C30H38O4Si and a molecular weight of 490.72 g/mol. Its IUPAC name is methyl (3aS,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-dimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate.
| Compound Name | methyl (3aS,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-dimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 102280155 |
| Molecular Formula | C30H38O4Si |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | methyl (3aS,7aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,5-dimethyl-4-oxo-3,6,7,7a-tetrahydroindene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=C[C@@H]1CCC(C)(C)C2=O |
| InChI | InChI=1S/C30H38O4Si/c1-28(2,3)35(24-13-9-7-10-14-24,25-15-11-8-12-16-25)34-21-22-19-23-17-18-29(4,5)26(31)30(23,20-22)27(32)33-6/h7-16,19,23H,17-18,20-21H2,1-6H3/t23-,30-/m0/s1 |
| InChIKey | TWUFLXGMDDRPDI-JHOBJCJYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|