About (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol
(1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol (PubChem CID 102280272) has the molecular formula C13H12F3NO
and a molecular weight of 255.24 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol |
| PubChem CID | 102280272 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol |
| SMILES | Cc1ccc([C@@](O)(c2ccc[nH]2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3NO/c1-9-4-6-10(7-5-9)12(18,13(14,15)16)11-3-2-8-17-11/h2-8,17-18H,1H3/t12-/m1/s1 |
| InChIKey | WJAOXHSVICLZNP-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol?
The IUPAC name of (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol (CID 102280272) is (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol.
What is the SMILES notation for (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol?
The canonical SMILES for (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol is Cc1ccc([C@@](O)(c2ccc[nH]2)C(F)(F)F)cc1.
What is the InChIKey of (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol?
The InChIKey is WJAOXHSVICLZNP-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H12F3NO/c1-9-4-6-10(7-5-9)12(18,13(14,15)16)11-3-2-8-17-11/h2-8,17-18H,1H3/t12-/m1/s1.
What are the key properties of (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol?
(1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol has a molecular weight of 255.24 g/mol, XLogP of 3.12, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trifluoro-1-(4-methylphenyl)-1-(1H-pyrrol-2-yl)ethanol is sourced from PubChem (CID 102280272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).