C17H21ClO — CID 102280433
(E)-2-(4-chlorophenyl)-5-(cyclohexen-1-yl)pent-3-en-2-ol (PubChem CID 102280433) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-5-(cyclohexen-1-yl)pent-3-en-2-ol.
| Compound Name | (E)-2-(4-chlorophenyl)-5-(cyclohexen-1-yl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 102280433 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-5-(cyclohexen-1-yl)pent-3-en-2-ol |
| SMILES | CC(O)(/C=C/CC1=CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClO/c1-17(19,15-9-11-16(18)12-10-15)13-5-8-14-6-3-2-4-7-14/h5-6,9-13,19H,2-4,7-8H2,1H3/b13-5+ |
| InChIKey | JYAOQQFNHHYSHF-WLRTZDKTSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|