About CID 102280620
CID 102280620 (PubChem CID 102280620) has the molecular formula C7H11Li2NO
and a molecular weight of 139.05 g/mol.
Molecular Properties
| Compound Name | CID 102280620 |
| PubChem CID | 102280620 |
| Molecular Formula | C7H11Li2NO |
| Molecular Weight | 139.05 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | — |
| SMILES | C/[C]=C(\[O-])N1CCCC1.[Li+].[Li] |
| InChI | InChI=1S/C7H12NO.2Li/c1-2-7(9)8-5-3-4-6-8;;/h9H,3-6H2,1H3;;/q;;+1/p-1 |
| InChIKey | FSOJSCZKLMXHPW-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.05 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze CID 102280620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102280620?
The IUPAC name of CID 102280620 (CID 102280620) is not available.
What is the SMILES notation for CID 102280620?
The canonical SMILES for CID 102280620 is C/[C]=C(\[O-])N1CCCC1.[Li+].[Li].
What is the InChIKey of CID 102280620?
The InChIKey is FSOJSCZKLMXHPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12NO.2Li/c1-2-7(9)8-5-3-4-6-8;;/h9H,3-6H2,1H3;;/q;;+1/p-1.
What are the key properties of CID 102280620?
CID 102280620 has a molecular weight of 139.05 g/mol, XLogP of -3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102280620 is sourced from PubChem (CID 102280620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).