About 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde
2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde (PubChem CID 102280664) has the molecular formula C19H16O3S
and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde |
| PubChem CID | 102280664 |
| Molecular Formula | C19H16O3S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde |
| SMILES | Cc1ccc(S(=O)/C=C\C(=C/C=O)c2ccccc2C=O)cc1 |
| InChI | InChI=1S/C19H16O3S/c1-15-6-8-18(9-7-15)23(22)13-11-16(10-12-20)19-5-3-2-4-17(19)14-21/h2-14H,1H3/b13-11-,16-10+ |
| InChIKey | NITSHXYKBORXOO-INBGBAMISA-N |
| XLogP | 3.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde?
The IUPAC name of 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde (CID 102280664) is 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde.
What is the SMILES notation for 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde?
The canonical SMILES for 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde is Cc1ccc(S(=O)/C=C\C(=C/C=O)c2ccccc2C=O)cc1.
What is the InChIKey of 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde?
The InChIKey is NITSHXYKBORXOO-INBGBAMISA-N. The full InChI is InChI=1S/C19H16O3S/c1-15-6-8-18(9-7-15)23(22)13-11-16(10-12-20)19-5-3-2-4-17(19)14-21/h2-14H,1H3/b13-11-,16-10+.
What are the key properties of 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde?
2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde has a molecular weight of 324.40 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z,3E)-1-(4-methylphenyl)sulfinyl-5-oxopenta-1,3-dien-3-yl]benzaldehyde is sourced from PubChem (CID 102280664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).