C28H24N2O3 — CID 102281229
2-(3,5-dimethylphenyl)-3,6-bis(4-methoxyphenyl)furo[2,3-b]pyrazine (PubChem CID 102281229) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-3,6-bis(4-methoxyphenyl)furo[2,3-b]pyrazine.
| Compound Name | 2-(3,5-dimethylphenyl)-3,6-bis(4-methoxyphenyl)furo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 102281229 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-3,6-bis(4-methoxyphenyl)furo[2,3-b]pyrazine |
| SMILES | COc1ccc(-c2cc3nc(-c4cc(C)cc(C)c4)c(-c4ccc(OC)cc4)nc3o2)cc1 |
| InChI | InChI=1S/C28H24N2O3/c1-17-13-18(2)15-21(14-17)27-26(20-7-11-23(32-4)12-8-20)30-28-24(29-27)16-25(33-28)19-5-9-22(31-3)10-6-19/h5-16H,1-4H3 |
| InChIKey | GHOJROIRLLLXTD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |