C13H13ClN2O — CID 102281813
3-chloro-9-methyl-5,6,7,8-tetrahydropyrido[3,4-b]indole-1-carbaldehyde (PubChem CID 102281813) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 3-chloro-9-methyl-5,6,7,8-tetrahydropyrido[3,4-b]indole-1-carbaldehyde.
| Compound Name | 3-chloro-9-methyl-5,6,7,8-tetrahydropyrido[3,4-b]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 102281813 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-chloro-9-methyl-5,6,7,8-tetrahydropyrido[3,4-b]indole-1-carbaldehyde |
| SMILES | Cn1c2c(c3cc(Cl)nc(C=O)c31)CCCC2 |
| InChI | InChI=1S/C13H13ClN2O/c1-16-11-5-3-2-4-8(11)9-6-12(14)15-10(7-17)13(9)16/h6-7H,2-5H2,1H3 |
| InChIKey | UFZVCUNQFNKZKW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|