About ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate
ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 102282046) has the molecular formula C14H25NO3S
and a molecular weight of 287.43 g/mol. Its IUPAC name is ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate |
| PubChem CID | 102282046 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(C)=C(C)CN1S(=O)C(C)(C)C |
| InChI | InChI=1S/C14H25NO3S/c1-7-18-13(16)12-8-10(2)11(3)9-15(12)19(17)14(4,5)6/h12H,7-9H2,1-6H3/t12-,19?/m0/s1 |
| InChIKey | COTACUQKULBMAV-HSLMYDHPSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate?
The IUPAC name of ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate (CID 102282046) is ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate.
What is the SMILES notation for ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate?
The canonical SMILES for ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate is CCOC(=O)[C@@H]1CC(C)=C(C)CN1S(=O)C(C)(C)C.
What is the InChIKey of ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate?
The InChIKey is COTACUQKULBMAV-HSLMYDHPSA-N. The full InChI is InChI=1S/C14H25NO3S/c1-7-18-13(16)12-8-10(2)11(3)9-15(12)19(17)14(4,5)6/h12H,7-9H2,1-6H3/t12-,19?/m0/s1.
What are the key properties of ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate?
ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate has a molecular weight of 287.43 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-1-tert-butylsulfinyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-2-carboxylate is sourced from PubChem (CID 102282046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).