C28H46O6 — CID 102282086
[(3S,3aR,6R,6aR)-6-undec-10-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] undec-10-enoate (PubChem CID 102282086) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-undec-10-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] undec-10-enoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-undec-10-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] undec-10-enoate |
|---|---|
| PubChem CID | 102282086 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-undec-10-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C28H46O6/c1-3-5-7-9-11-13-15-17-19-25(29)33-23-21-31-28-24(22-32-27(23)28)34-26(30)20-18-16-14-12-10-8-6-4-2/h3-4,23-24,27-28H,1-2,5-22H2/t23-,24+,27-,28-/m1/s1 |
| InChIKey | ZQASHZUWNIYLNX-WKWYISCVSA-N |
| XLogP | 6.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|