C25H30N2O — CID 102282092
2-methyl-6,6-bis(1-methylindol-3-yl)hexan-3-ol (PubChem CID 102282092) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-methyl-6,6-bis(1-methylindol-3-yl)hexan-3-ol.
| Compound Name | 2-methyl-6,6-bis(1-methylindol-3-yl)hexan-3-ol |
|---|---|
| PubChem CID | 102282092 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-methyl-6,6-bis(1-methylindol-3-yl)hexan-3-ol |
| SMILES | CC(C)C(O)CCC(c1cn(C)c2ccccc12)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C25H30N2O/c1-17(2)25(28)14-13-18(21-15-26(3)23-11-7-5-9-19(21)23)22-16-27(4)24-12-8-6-10-20(22)24/h5-12,15-18,25,28H,13-14H2,1-4H3 |
| InChIKey | KNKUMRDXBKVQNC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 30.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |