C10H14O2 — CID 102282183
(1S,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 102282183) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 102282183 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1S,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | C/C=C/C[C@]12O[C@H]1CCCC2=O |
| InChI | InChI=1S/C10H14O2/c1-2-3-7-10-8(11)5-4-6-9(10)12-10/h2-3,9H,4-7H2,1H3/b3-2+/t9-,10+/m0/s1 |
| InChIKey | CHEBOQUKOJCEJL-MDCNRGEUSA-N |
| XLogP | 1.84 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|