C12H20O7 — CID 102282442
methyl (2R,3S)-2,3-diacetyloxy-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 102282442) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (2R,3S)-2,3-diacetyloxy-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl (2R,3S)-2,3-diacetyloxy-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 102282442 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl (2R,3S)-2,3-diacetyloxy-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)[C@H](OC(C)=O)[C@H](OC(C)=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20O7/c1-7(13)17-9(10(15)16-6)11(18-8(2)14)19-12(3,4)5/h9,11H,1-6H3/t9-,11+/m0/s1 |
| InChIKey | VPSFMADHNPXGGA-GXSJLCMTSA-N |
| XLogP | 0.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|