C22H22O13S — CID 102282738
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]-6-(hydroxymethyl)oxan-3-yl] hydrogen sulfate (PubChem CID 102282738) has the molecular formula C22H22O13S and a molecular weight of 526.47 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]-6-(hydroxymethyl)oxan-3-yl] hydrogen sulfate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]-6-(hydroxymethyl)oxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 102282738 |
| Molecular Formula | C22H22O13S |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]-6-(hydroxymethyl)oxan-3-yl] hydrogen sulfate |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4OS(=O)(=O)O)cc3o2)ccc1O |
| InChI | InChI=1S/C22H22O13S/c1-32-15-5-9(2-3-11(15)24)14-7-13(26)18-12(25)4-10(6-16(18)33-14)21-22(35-36(29,30)31)20(28)19(27)17(8-23)34-21/h2-7,17,19-25,27-28H,8H2,1H3,(H,29,30,31)/t17-,19-,20+,21+,22-/m1/s1 |
| InChIKey | CTVBJWAUSZZSLB-MBMVPVEPSA-N |
| XLogP | 0.22 |
| TPSA | 213.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|