C14H2Br2F5OPS2 — CID 102283025
4,10-dibromo-7-(2,3,4,5,6-pentafluorophenyl)-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide (PubChem CID 102283025) has the molecular formula C14H2Br2F5OPS2 and a molecular weight of 536.08 g/mol. Its IUPAC name is 4,10-dibromo-7-(2,3,4,5,6-pentafluorophenyl)-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide.
| Compound Name | 4,10-dibromo-7-(2,3,4,5,6-pentafluorophenyl)-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide |
|---|---|
| PubChem CID | 102283025 |
| Molecular Formula | C14H2Br2F5OPS2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 533.76 |
| IUPAC Name | 4,10-dibromo-7-(2,3,4,5,6-pentafluorophenyl)-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide |
| SMILES | O=P1(c2c(F)c(F)c(F)c(F)c2F)c2cc(Br)sc2-c2sc(Br)cc21 |
| InChI | InChI=1S/C14H2Br2F5OPS2/c15-5-1-3-13(24-5)14-4(2-6(16)25-14)23(3,22)12-10(20)8(18)7(17)9(19)11(12)21/h1-2H |
| InChIKey | DMTYPAJOHAWQMK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|