C22H24O5 — CID 102283068
ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-2-naphthalen-1-yl-7-oxo-6-oxabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 102283068) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-2-naphthalen-1-yl-7-oxo-6-oxabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-2-naphthalen-1-yl-7-oxo-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 102283068 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | ethyl (1S,2R,3R,5R)-5-(2-hydroxypropan-2-yl)-2-naphthalen-1-yl-7-oxo-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@]2(C(C)(C)O)OC(=O)[C@H]2[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C22H24O5/c1-4-26-19(23)16-12-22(21(2,3)25)18(20(24)27-22)17(16)15-11-7-9-13-8-5-6-10-14(13)15/h5-11,16-18,25H,4,12H2,1-3H3/t16-,17-,18-,22-/m1/s1 |
| InChIKey | FDPIWZRXLBWUDQ-OZQHCQBDSA-N |
| XLogP | 3.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|