C8H5F7N2O3 — CID 102283407
ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 102283407) has the molecular formula C8H5F7N2O3 and a molecular weight of 310.13 g/mol. Its IUPAC name is ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 102283407 |
| Molecular Formula | C8H5F7N2O3 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5F7N2O3/c1-2-19-4(18)3-16-5(20-17-3)6(9,10)7(11,12)8(13,14)15/h2H2,1H3 |
| InChIKey | BTHWYMHGWVEGCP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|