C18H20 — CID 102284055
(1S,2S,3S)-1-ethyl-2-methyl-3-phenyl-2,3-dihydro-1H-indene (PubChem CID 102284055) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,2S,3S)-1-ethyl-2-methyl-3-phenyl-2,3-dihydro-1H-indene.
| Compound Name | (1S,2S,3S)-1-ethyl-2-methyl-3-phenyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 102284055 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1S,2S,3S)-1-ethyl-2-methyl-3-phenyl-2,3-dihydro-1H-indene |
| SMILES | CC[C@@H]1c2ccccc2[C@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C18H20/c1-3-15-13(2)18(14-9-5-4-6-10-14)17-12-8-7-11-16(15)17/h4-13,15,18H,3H2,1-2H3/t13-,15-,18-/m0/s1 |
| InChIKey | KHKCHKOTWQNMMD-YEWWUXTCSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |