About 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline
3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline (PubChem CID 102285128) has the molecular formula C26H49NP2
and a molecular weight of 437.63 g/mol. Its IUPAC name is 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline |
| PubChem CID | 102285128 |
| Molecular Formula | C26H49NP2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(CP(C(C)(C)C)C(C)(C)C)cc(CP(C(C)(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H49NP2/c1-23(2,3)28(24(4,5)6)18-20-15-21(17-22(16-20)27(13)14)19-29(25(7,8)9)26(10,11)12/h15-17H,18-19H2,1-14H3 |
| InChIKey | BTIQEOYOOWKEKB-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline?
The IUPAC name of 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline (CID 102285128) is 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline.
What is the SMILES notation for 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline?
The canonical SMILES for 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline is CN(C)c1cc(CP(C(C)(C)C)C(C)(C)C)cc(CP(C(C)(C)C)C(C)(C)C)c1.
What is the InChIKey of 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline?
The InChIKey is BTIQEOYOOWKEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H49NP2/c1-23(2,3)28(24(4,5)6)18-20-15-21(17-22(16-20)27(13)14)19-29(25(7,8)9)26(10,11)12/h15-17H,18-19H2,1-14H3.
What are the key properties of 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline?
3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline has a molecular weight of 437.63 g/mol, XLogP of 8.91, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(ditert-butylphosphanylmethyl)-N,N-dimethylaniline is sourced from PubChem (CID 102285128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).