C30H44N3NaO6S — CID 102285574
sodium [2-[2-[(1S,2S,4aR)-1,2,6,6-tetramethyl-2,3,4,4a,5,7-hexahydronaphthalen-1-yl]ethyl]-5-[1-[2-(1H-imidazol-5-yl)ethyl]-2,5-dioxopyrrol-3-yl]pentyl] sulfate (PubChem CID 102285574) has the molecular formula C30H44N3NaO6S and a molecular weight of 597.75 g/mol. Its IUPAC name is sodium [2-[2-[(1S,2S,4aR)-1,2,6,6-tetramethyl-2,3,4,4a,5,7-hexahydronaphthalen-1-yl]ethyl]-5-[1-[2-(1H-imidazol-5-yl)ethyl]-2,5-dioxopyrrol-3-yl]pentyl] sulfate.
| Compound Name | sodium [2-[2-[(1S,2S,4aR)-1,2,6,6-tetramethyl-2,3,4,4a,5,7-hexahydronaphthalen-1-yl]ethyl]-5-[1-[2-(1H-imidazol-5-yl)ethyl]-2,5-dioxopyrrol-3-yl]pentyl] sulfate |
|---|---|
| PubChem CID | 102285574 |
| Molecular Formula | C30H44N3NaO6S |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | sodium [2-[2-[(1S,2S,4aR)-1,2,6,6-tetramethyl-2,3,4,4a,5,7-hexahydronaphthalen-1-yl]ethyl]-5-[1-[2-(1H-imidazol-5-yl)ethyl]-2,5-dioxopyrrol-3-yl]pentyl] sulfate |
| SMILES | C[C@H]1CC[C@@H]2CC(C)(C)CC=C2[C@@]1(C)CCC(CCCC1=CC(=O)N(CCc2cnc[nH]2)C1=O)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C30H45N3O6S.Na/c1-21-8-9-24-17-29(2,3)13-11-26(24)30(21,4)14-10-22(19-39-40(36,37)38)6-5-7-23-16-27(34)33(28(23)35)15-12-25-18-31-20-32-25;/h11,16,18,20-22,24H,5-10,12-15,17,19H2,1-4H3,(H,31,32)(H,36,37,38);/q;+1/p-1/t21-,22?,24+,30-;/m0./s1 |
| InChIKey | VMEORRGCIZQWSJ-YLJDJFDVSA-M |
| XLogP | 2.09 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|