C21H30O5 — CID 102285912
(1S,3S,5S,7S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4,7-trimethyl-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione (PubChem CID 102285912) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,3S,5S,7S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4,7-trimethyl-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione.
| Compound Name | (1S,3S,5S,7S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4,7-trimethyl-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
|---|---|
| PubChem CID | 102285912 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,3S,5S,7S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4,7-trimethyl-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
| SMILES | CC(C)C(=O)C1=C(O)[C@]2(C)C[C@H]3C(C)(C)[C@@H](C(C)(C)O)C[C@@]3(C1=O)C2=O |
| InChI | InChI=1S/C21H30O5/c1-10(2)14(22)13-15(23)20(7)8-12-18(3,4)11(19(5,6)26)9-21(12,16(13)24)17(20)25/h10-12,23,26H,8-9H2,1-7H3/t11-,12-,20-,21+/m0/s1 |
| InChIKey | CFHAUVDSEYXYMD-FFHKOHFQSA-N |
| XLogP | 3.01 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|