C28H27F6NO5 — CID 102285985
ditert-butyl 2-[[6-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)benzo[h]quinolin-3-yl]methyl]propanedioate (PubChem CID 102285985) has the molecular formula C28H27F6NO5 and a molecular weight of 571.51 g/mol. Its IUPAC name is ditert-butyl 2-[[6-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)benzo[h]quinolin-3-yl]methyl]propanedioate.
| Compound Name | ditert-butyl 2-[[6-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)benzo[h]quinolin-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 102285985 |
| Molecular Formula | C28H27F6NO5 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | ditert-butyl 2-[[6-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)benzo[h]quinolin-3-yl]methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(Cc1cnc2c(cc(C(=O)C(F)(F)F)c3ccccc32)c1C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H27F6NO5/c1-25(2,3)39-23(37)19(24(38)40-26(4,5)6)11-14-13-35-21-16-10-8-7-9-15(16)17(22(36)28(32,33)34)12-18(21)20(14)27(29,30)31/h7-10,12-13,19H,11H2,1-6H3 |
| InChIKey | RFHKFZNMZNRPMW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|