About 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole
2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole (PubChem CID 102286362) has the molecular formula C33H24N6
and a molecular weight of 504.60 g/mol. Its IUPAC name is 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole.
Molecular Properties
| Compound Name | 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole |
| PubChem CID | 102286362 |
| Molecular Formula | C33H24N6 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole |
| SMILES | c1ccc(-n2ccnc2-c2cc(-c3nccn3-c3ccccc3)cc(-c3nccn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H24N6/c1-4-10-28(11-5-1)37-19-16-34-31(37)25-22-26(32-35-17-20-38(32)29-12-6-2-7-13-29)24-27(23-25)33-36-18-21-39(33)30-14-8-3-9-15-30/h1-24H |
| InChIKey | LHSSYZFSZCIHAP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole?
The IUPAC name of 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole (CID 102286362) is 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole.
What is the SMILES notation for 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole?
The canonical SMILES for 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole is c1ccc(-n2ccnc2-c2cc(-c3nccn3-c3ccccc3)cc(-c3nccn3-c3ccccc3)c2)cc1.
What is the InChIKey of 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole?
The InChIKey is LHSSYZFSZCIHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24N6/c1-4-10-28(11-5-1)37-19-16-34-31(37)25-22-26(32-35-17-20-38(32)29-12-6-2-7-13-29)24-27(23-25)33-36-18-21-39(33)30-14-8-3-9-15-30/h1-24H.
What are the key properties of 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole?
2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole has a molecular weight of 504.60 g/mol, XLogP of 7.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(1-phenylimidazol-2-yl)phenyl]-1-phenylimidazole is sourced from PubChem (CID 102286362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).