C19H28O4 — CID 102286663
diethyl (3aS)-5,7,7-trimethyl-1,3,3a,6-tetrahydroazulene-2,2-dicarboxylate (PubChem CID 102286663) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is diethyl (3aS)-5,7,7-trimethyl-1,3,3a,6-tetrahydroazulene-2,2-dicarboxylate.
| Compound Name | diethyl (3aS)-5,7,7-trimethyl-1,3,3a,6-tetrahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102286663 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | diethyl (3aS)-5,7,7-trimethyl-1,3,3a,6-tetrahydroazulene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CC(C)(C)CC(C)=C[C@@H]2C1 |
| InChI | InChI=1S/C19H28O4/c1-6-22-16(20)19(17(21)23-7-2)11-14-8-13(3)9-18(4,5)10-15(14)12-19/h8,10,14H,6-7,9,11-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | PLCWEWRAWDCICL-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|