About CID 102286941
CID 102286941 (PubChem CID 102286941) has the molecular formula C7H16N2O2+
and a molecular weight of 160.22 g/mol.
Molecular Properties
| Compound Name | CID 102286941 |
| PubChem CID | 102286941 |
| Molecular Formula | C7H16N2O2+ |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | — |
| SMILES | CCN(C)OC(=[O+])N(C)CC |
| InChI | InChI=1S/C7H16N2O2/c1-5-8(3)7(10)11-9(4)6-2/h5-6H2,1-4H3/q+1 |
| InChIKey | DUDQKIBTHBWLRB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 35.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102286941 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102286941?
The IUPAC name of CID 102286941 (CID 102286941) is not available.
What is the SMILES notation for CID 102286941?
The canonical SMILES for CID 102286941 is CCN(C)OC(=[O+])N(C)CC.
What is the InChIKey of CID 102286941?
The InChIKey is DUDQKIBTHBWLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-5-8(3)7(10)11-9(4)6-2/h5-6H2,1-4H3/q+1.
What are the key properties of CID 102286941?
CID 102286941 has a molecular weight of 160.22 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102286941 is sourced from PubChem (CID 102286941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).