About methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate
methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate (PubChem CID 102287247) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate |
| PubChem CID | 102287247 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NCC1C=CC=C1 |
| InChI | InChI=1S/C10H15NO3/c1-14-10(13)9(7-12)11-6-8-4-2-3-5-8/h2-5,8-9,11-12H,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | WBRJUQNKIXAGAS-VIFPVBQESA-N |
| XLogP | -0.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate?
The IUPAC name of methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate (CID 102287247) is methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate.
What is the SMILES notation for methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate?
The canonical SMILES for methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate is COC(=O)[C@H](CO)NCC1C=CC=C1.
What is the InChIKey of methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate?
The InChIKey is WBRJUQNKIXAGAS-VIFPVBQESA-N. The full InChI is InChI=1S/C10H15NO3/c1-14-10(13)9(7-12)11-6-8-4-2-3-5-8/h2-5,8-9,11-12H,6-7H2,1H3/t9-/m0/s1.
What are the key properties of methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate?
methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate has a molecular weight of 197.23 g/mol, XLogP of -0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(cyclopenta-2,4-dien-1-ylmethylamino)-3-hydroxypropanoate is sourced from PubChem (CID 102287247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).