C11H20ClN3O2 — CID 102287325
1-[(2S)-3-(2-chloropiperazin-1-yl)-2-hydroxypropyl]pyrrolidin-2-one (PubChem CID 102287325) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-[(2S)-3-(2-chloropiperazin-1-yl)-2-hydroxypropyl]pyrrolidin-2-one.
| Compound Name | 1-[(2S)-3-(2-chloropiperazin-1-yl)-2-hydroxypropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102287325 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-[(2S)-3-(2-chloropiperazin-1-yl)-2-hydroxypropyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@H](O)CN1CCNCC1Cl |
| InChI | InChI=1S/C11H20ClN3O2/c12-10-6-13-3-5-14(10)7-9(16)8-15-4-1-2-11(15)17/h9-10,13,16H,1-8H2/t9-,10?/m1/s1 |
| InChIKey | OZBONSCPVPHNCK-YHMJZVADSA-N |
| XLogP | -0.56 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|