C20H20F3NO — CID 102287817
(2S,3R)-N-benzyl-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-amine (PubChem CID 102287817) has the molecular formula C20H20F3NO and a molecular weight of 347.38 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-amine.
| Compound Name | (2S,3R)-N-benzyl-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-amine |
|---|---|
| PubChem CID | 102287817 |
| Molecular Formula | C20H20F3NO |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2S,3R)-N-benzyl-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-amine |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](C#CC(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C20H20F3NO/c1-16(25-15-18-10-6-3-7-11-18)19(12-13-20(21,22)23)24-14-17-8-4-2-5-9-17/h2-11,16,19,24H,14-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | OHFFOCVGALLICB-QFBILLFUSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|