About 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid
11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid (PubChem CID 102287892) has the molecular formula C17H10N2O4
and a molecular weight of 306.28 g/mol. Its IUPAC name is 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid.
Molecular Properties
| Compound Name | 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid |
| PubChem CID | 102287892 |
| Molecular Formula | C17H10N2O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c3c4ccccc4nc(C(=O)O)c3c2c1 |
| InChI | InChI=1S/C17H10N2O4/c20-16(21)8-5-6-12-10(7-8)13-14(18-12)9-3-1-2-4-11(9)19-15(13)17(22)23/h1-7,18H,(H,20,21)(H,22,23) |
| InChIKey | KUXATRZLTYYNKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The IUPAC name of 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid (CID 102287892) is 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid.
What is the SMILES notation for 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The canonical SMILES for 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid is O=C(O)c1ccc2[nH]c3c4ccccc4nc(C(=O)O)c3c2c1.
What is the InChIKey of 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The InChIKey is KUXATRZLTYYNKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O4/c20-16(21)8-5-6-12-10(7-8)13-14(18-12)9-3-1-2-4-11(9)19-15(13)17(22)23/h1-7,18H,(H,20,21)(H,22,23).
What are the key properties of 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid has a molecular weight of 306.28 g/mol, XLogP of 3.27, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid is sourced from PubChem (CID 102287892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).