About 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid
5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 102287994) has the molecular formula C20H11Cl2NO5
and a molecular weight of 416.22 g/mol. Its IUPAC name is 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
Molecular Properties
| Compound Name | 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| PubChem CID | 102287994 |
| Molecular Formula | C20H11Cl2NO5 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H11Cl2NO5/c21-13-4-11-17(6-15(13)24)28-18-7-16(25)14(22)5-12(18)19(11)9-2-1-8(23)3-10(9)20(26)27/h1-7,24H,23H2,(H,26,27) |
| InChIKey | SPUQPVWBTZRUMM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The IUPAC name of 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (CID 102287994) is 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
What is the SMILES notation for 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The canonical SMILES for 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid is Nc1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)c(C(=O)O)c1.
What is the InChIKey of 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
The InChIKey is SPUQPVWBTZRUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Cl2NO5/c21-13-4-11-17(6-15(13)24)28-18-7-16(25)14(22)5-12(18)19(11)9-2-1-8(23)3-10(9)20(26)27/h1-7,24H,23H2,(H,26,27).
What are the key properties of 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid?
5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid has a molecular weight of 416.22 g/mol, XLogP of 4.86, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid is sourced from PubChem (CID 102287994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).