C18H21F3O5S — CID 102287999
methyl 2-[4-methyl-1-(trifluoromethylsulfonyl)pentan-2-yl]-3-oxo-1H-indene-2-carboxylate (PubChem CID 102287999) has the molecular formula C18H21F3O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is methyl 2-[4-methyl-1-(trifluoromethylsulfonyl)pentan-2-yl]-3-oxo-1H-indene-2-carboxylate.
| Compound Name | methyl 2-[4-methyl-1-(trifluoromethylsulfonyl)pentan-2-yl]-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102287999 |
| Molecular Formula | C18H21F3O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | methyl 2-[4-methyl-1-(trifluoromethylsulfonyl)pentan-2-yl]-3-oxo-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1(C(CC(C)C)CS(=O)(=O)C(F)(F)F)Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H21F3O5S/c1-11(2)8-13(10-27(24,25)18(19,20)21)17(16(23)26-3)9-12-6-4-5-7-14(12)15(17)22/h4-7,11,13H,8-10H2,1-3H3 |
| InChIKey | VVEHNQKBPGHTKR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|