C19H23F3O5S — CID 102288001
methyl 3-oxo-2-[1-(trifluoromethylsulfonyl)heptan-2-yl]-1H-indene-2-carboxylate (PubChem CID 102288001) has the molecular formula C19H23F3O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is methyl 3-oxo-2-[1-(trifluoromethylsulfonyl)heptan-2-yl]-1H-indene-2-carboxylate.
| Compound Name | methyl 3-oxo-2-[1-(trifluoromethylsulfonyl)heptan-2-yl]-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102288001 |
| Molecular Formula | C19H23F3O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | methyl 3-oxo-2-[1-(trifluoromethylsulfonyl)heptan-2-yl]-1H-indene-2-carboxylate |
| SMILES | CCCCCC(CS(=O)(=O)C(F)(F)F)C1(C(=O)OC)Cc2ccccc2C1=O |
| InChI | InChI=1S/C19H23F3O5S/c1-3-4-5-9-14(12-28(25,26)19(20,21)22)18(17(24)27-2)11-13-8-6-7-10-15(13)16(18)23/h6-8,10,14H,3-5,9,11-12H2,1-2H3 |
| InChIKey | IIHYNHYECAOOIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|