About 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one
2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one (PubChem CID 102288044) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one |
| PubChem CID | 102288044 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)cc(C2=NC(c3ccccc3)C(=O)O2)c1 |
| InChI | InChI=1S/C17H15NO4/c1-20-13-8-12(9-14(10-13)21-2)16-18-15(17(19)22-16)11-6-4-3-5-7-11/h3-10,15H,1-2H3 |
| InChIKey | XKFKMNDBMZLTBW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one?
The IUPAC name of 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one (CID 102288044) is 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one?
The canonical SMILES for 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one is COc1cc(OC)cc(C2=NC(c3ccccc3)C(=O)O2)c1.
What is the InChIKey of 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one?
The InChIKey is XKFKMNDBMZLTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-20-13-8-12(9-14(10-13)21-2)16-18-15(17(19)22-16)11-6-4-3-5-7-11/h3-10,15H,1-2H3.
What are the key properties of 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one?
2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one has a molecular weight of 297.31 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyphenyl)-4-phenyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 102288044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).