About ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate
ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate (PubChem CID 102288108) has the molecular formula C13H18O7
and a molecular weight of 286.28 g/mol. Its IUPAC name is ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate |
| PubChem CID | 102288108 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@H](CC(=O)OCC)C(=O)OC1=O |
| InChI | InChI=1S/C13H18O7/c1-3-18-10(14)6-8-5-9(7-11(15)19-4-2)13(17)20-12(8)16/h8-9H,3-7H2,1-2H3/t8-,9+ |
| InChIKey | OEEMUHLRNSMDIM-DTORHVGOSA-N |
| XLogP | 0.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate?
The IUPAC name of ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate (CID 102288108) is ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate.
What is the SMILES notation for ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate?
The canonical SMILES for ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate is CCOC(=O)C[C@@H]1C[C@H](CC(=O)OCC)C(=O)OC1=O.
What is the InChIKey of ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate?
The InChIKey is OEEMUHLRNSMDIM-DTORHVGOSA-N. The full InChI is InChI=1S/C13H18O7/c1-3-18-10(14)6-8-5-9(7-11(15)19-4-2)13(17)20-12(8)16/h8-9H,3-7H2,1-2H3/t8-,9+.
What are the key properties of ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate?
ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate has a molecular weight of 286.28 g/mol, XLogP of 0.60, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3R,5S)-5-(2-ethoxy-2-oxoethyl)-2,6-dioxooxan-3-yl]acetate is sourced from PubChem (CID 102288108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).