C42H37N3O7 — CID 102288796
4-[[4-[(4-amino-2-propan-2-yloxybenzoyl)amino]-2-(2-methylnaphthalen-1-yl)oxybenzoyl]amino]-2-phenylmethoxybenzoic acid (PubChem CID 102288796) has the molecular formula C42H37N3O7 and a molecular weight of 695.77 g/mol. Its IUPAC name is 4-[[4-[(4-amino-2-propan-2-yloxybenzoyl)amino]-2-(2-methylnaphthalen-1-yl)oxybenzoyl]amino]-2-phenylmethoxybenzoic acid.
| Compound Name | 4-[[4-[(4-amino-2-propan-2-yloxybenzoyl)amino]-2-(2-methylnaphthalen-1-yl)oxybenzoyl]amino]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 102288796 |
| Molecular Formula | C42H37N3O7 |
| Molecular Weight | 695.77 g/mol |
| Exact Mass | 695.26 |
| IUPAC Name | 4-[[4-[(4-amino-2-propan-2-yloxybenzoyl)amino]-2-(2-methylnaphthalen-1-yl)oxybenzoyl]amino]-2-phenylmethoxybenzoic acid |
| SMILES | Cc1ccc2ccccc2c1Oc1cc(NC(=O)c2ccc(N)cc2OC(C)C)ccc1C(=O)Nc1ccc(C(=O)O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C42H37N3O7/c1-25(2)51-37-21-29(43)15-18-33(37)40(46)45-31-16-19-34(38(23-31)52-39-26(3)13-14-28-11-7-8-12-32(28)39)41(47)44-30-17-20-35(42(48)49)36(22-30)50-24-27-9-5-4-6-10-27/h4-23,25H,24,43H2,1-3H3,(H,44,47)(H,45,46)(H,48,49) |
| InChIKey | AIFKWJBDZKPEPA-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.77 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|