C14H14FN5 — CID 102288819
4-fluoro-N,N-bis(pyrazol-1-ylmethyl)aniline (PubChem CID 102288819) has the molecular formula C14H14FN5 and a molecular weight of 271.30 g/mol. Its IUPAC name is 4-fluoro-N,N-bis(pyrazol-1-ylmethyl)aniline.
| Compound Name | 4-fluoro-N,N-bis(pyrazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 102288819 |
| Molecular Formula | C14H14FN5 |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-fluoro-N,N-bis(pyrazol-1-ylmethyl)aniline |
| SMILES | Fc1ccc(N(Cn2cccn2)Cn2cccn2)cc1 |
| InChI | InChI=1S/C14H14FN5/c15-13-3-5-14(6-4-13)18(11-19-9-1-7-16-19)12-20-10-2-8-17-20/h1-10H,11-12H2 |
| InChIKey | ZGAALYUPUFPVLP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |