C44H48N2O4S — CID 102288920
(E)-2-cyano-3-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4-thiatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl]prop-2-enoic acid (PubChem CID 102288920) has the molecular formula C44H48N2O4S and a molecular weight of 700.94 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4-thiatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4-thiatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102288920 |
| Molecular Formula | C44H48N2O4S |
| Molecular Weight | 700.94 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4-thiatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3sc(/C=C(\C#N)C(=O)O)c4c3C3C=CC4CC3)cc2)cc1 |
| InChI | InChI=1S/C44H48N2O4S/c1-3-5-7-9-27-49-38-23-19-36(20-24-38)46(37-21-25-39(26-22-37)50-28-10-8-6-4-2)35-17-15-33(16-18-35)43-42-32-13-11-31(12-14-32)41(42)40(51-43)29-34(30-45)44(47)48/h11,13,15-26,29,31-32H,3-10,12,14,27-28H2,1-2H3,(H,47,48)/b34-29+ |
| InChIKey | IMESZNPTNRDXPX-RIHQVDFKSA-N |
| XLogP | 12.33 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.94 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|