C13H20O3 — CID 102289877
methyl (2R,4E,7R)-2,7-dimethyl-9-oxocyclonon-4-ene-1-carboxylate (PubChem CID 102289877) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl (2R,4E,7R)-2,7-dimethyl-9-oxocyclonon-4-ene-1-carboxylate.
| Compound Name | methyl (2R,4E,7R)-2,7-dimethyl-9-oxocyclonon-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 102289877 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methyl (2R,4E,7R)-2,7-dimethyl-9-oxocyclonon-4-ene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@H](C)C/C=C/C[C@H]1C |
| InChI | InChI=1S/C13H20O3/c1-9-6-4-5-7-10(2)12(11(14)8-9)13(15)16-3/h4-5,9-10,12H,6-8H2,1-3H3/b5-4+/t9-,10-,12?/m1/s1 |
| InChIKey | BTGKSLKETCFNSJ-DVUROVSISA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|