C17H28O2S — CID 102289935
cis-(1S,2S)-1-(1-ethylsulfanylethenyl)-2-[(E)-1-prop-2-enoxybut-2-en-2-yl]cyclohexan-1-ol (PubChem CID 102289935) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is cis-(1S,2S)-1-(1-ethylsulfanylethenyl)-2-[(E)-1-prop-2-enoxybut-2-en-2-yl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-1-(1-ethylsulfanylethenyl)-2-[(E)-1-prop-2-enoxybut-2-en-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102289935 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | cis-(1S,2S)-1-(1-ethylsulfanylethenyl)-2-[(E)-1-prop-2-enoxybut-2-en-2-yl]cyclohexan-1-ol |
| SMILES | C=CCOC/C(=C/C)[C@@H]1CCCC[C@@]1(O)C(=C)SCC |
| InChI | InChI=1S/C17H28O2S/c1-5-12-19-13-15(6-2)16-10-8-9-11-17(16,18)14(4)20-7-3/h5-6,16,18H,1,4,7-13H2,2-3H3/b15-6-/t16-,17+/m0/s1 |
| InChIKey | WVJUABJORPGUBQ-AKLXSSKXSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|