C42H24F9N3 — CID 102289993
2,4,6-tris[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 102289993) has the molecular formula C42H24F9N3 and a molecular weight of 741.66 g/mol. Its IUPAC name is 2,4,6-tris[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102289993 |
| Molecular Formula | C42H24F9N3 |
| Molecular Weight | 741.66 g/mol |
| Exact Mass | 741.18 |
| IUPAC Name | 2,4,6-tris[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | FC(F)(F)c1ccccc1-c1cccc(-c2nc(-c3cccc(-c4ccccc4C(F)(F)F)c3)nc(-c3cccc(-c4ccccc4C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C42H24F9N3/c43-40(44,45)34-19-4-1-16-31(34)25-10-7-13-28(22-25)37-52-38(29-14-8-11-26(23-29)32-17-2-5-20-35(32)41(46,47)48)54-39(53-37)30-15-9-12-27(24-30)33-18-3-6-21-36(33)42(49,50)51/h1-24H |
| InChIKey | UWKHFKFFSBTWCH-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.66 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |