About phenanthren-9-ol
phenanthren-9-ol (PubChem CID 10229) has the molecular formula C14H10O
and a molecular weight of 194.23 g/mol. Its IUPAC name is phenanthren-9-ol.
Molecular Properties
| Compound Name | phenanthren-9-ol |
| PubChem CID | 10229 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | phenanthren-9-ol |
| SMILES | Oc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| InChIKey | DZKIUEHLEXLYKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthren-9-ol?
The IUPAC name of phenanthren-9-ol (CID 10229) is phenanthren-9-ol.
What is the SMILES notation for phenanthren-9-ol?
The canonical SMILES for phenanthren-9-ol is Oc1cc2ccccc2c2ccccc12.
What is the InChIKey of phenanthren-9-ol?
The InChIKey is DZKIUEHLEXLYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H.
What are the key properties of phenanthren-9-ol?
phenanthren-9-ol has a molecular weight of 194.23 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthren-9-ol is sourced from PubChem (CID 10229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).