About (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione
(3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione (PubChem CID 102290198) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione.
Molecular Properties
| Compound Name | (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione |
| PubChem CID | 102290198 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)N/C(=C\C(C)(C)C)C1=O |
| InChI | InChI=1S/C11H16N2O3/c1-7(14)13-6-9(15)12-8(10(13)16)5-11(2,3)4/h5H,6H2,1-4H3,(H,12,15)/b8-5- |
| InChIKey | QKZJIQWHTIPJMO-YVMONPNESA-N |
| XLogP | 0.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione?
The IUPAC name of (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione (CID 102290198) is (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione.
What is the SMILES notation for (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione?
The canonical SMILES for (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione is CC(=O)N1CC(=O)N/C(=C\C(C)(C)C)C1=O.
What is the InChIKey of (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione?
The InChIKey is QKZJIQWHTIPJMO-YVMONPNESA-N. The full InChI is InChI=1S/C11H16N2O3/c1-7(14)13-6-9(15)12-8(10(13)16)5-11(2,3)4/h5H,6H2,1-4H3,(H,12,15)/b8-5-.
What are the key properties of (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione?
(3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione has a molecular weight of 224.26 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-acetyl-3-(2,2-dimethylpropylidene)piperazine-2,5-dione is sourced from PubChem (CID 102290198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).