C36H40B2N2 — CID 102290707
[4-[2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 102290707) has the molecular formula C36H40B2N2 and a molecular weight of 522.35 g/mol. Its IUPAC name is [4-[2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 102290707 |
| Molecular Formula | C36H40B2N2 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | [4-[2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)ethynyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | CCN1B(C#Cc2ccc(B(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)cc2)N(CC)c2ccccc21 |
| InChI | InChI=1S/C36H40B2N2/c1-9-39-33-13-11-12-14-34(33)40(10-2)37(39)20-19-31-15-17-32(18-16-31)38(35-27(5)21-25(3)22-28(35)6)36-29(7)23-26(4)24-30(36)8/h11-18,21-24H,9-10H2,1-8H3 |
| InChIKey | RTWUNPKOSHGUOJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|