C28H28BN2PS — CID 102290733
[4-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 102290733) has the molecular formula C28H28BN2PS and a molecular weight of 466.40 g/mol. Its IUPAC name is [4-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [4-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102290733 |
| Molecular Formula | C28H28BN2PS |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [4-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CCN1B(c2ccc(P(=S)(c3ccccc3)c3ccccc3)cc2)N(CC)c2ccccc21 |
| InChI | InChI=1S/C28H28BN2PS/c1-3-30-27-17-11-12-18-28(27)31(4-2)29(30)23-19-21-26(22-20-23)32(33,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-22H,3-4H2,1-2H3 |
| InChIKey | SODKSPZZMOKEGJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|