C23H20N2O — CID 102290784
11,11-dimethyl-14-(4-methylphenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one (PubChem CID 102290784) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 11,11-dimethyl-14-(4-methylphenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one.
| Compound Name | 11,11-dimethyl-14-(4-methylphenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 102290784 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 11,11-dimethyl-14-(4-methylphenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaen-15-one |
| SMILES | Cc1ccc(N2C(=O)c3c4c(nc5ccccc35)CC(C)(C)C=C42)cc1 |
| InChI | InChI=1S/C23H20N2O/c1-14-8-10-15(11-9-14)25-19-13-23(2,3)12-18-21(19)20(22(25)26)16-6-4-5-7-17(16)24-18/h4-11,13H,12H2,1-3H3 |
| InChIKey | IVKFOYUKDPJRHR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |