About 6-chloro-2-phenyl-4H-3,1-benzoxazine
6-chloro-2-phenyl-4H-3,1-benzoxazine (PubChem CID 102290950) has the molecular formula C14H10ClNO
and a molecular weight of 243.69 g/mol. Its IUPAC name is 6-chloro-2-phenyl-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-2-phenyl-4H-3,1-benzoxazine |
| PubChem CID | 102290950 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 6-chloro-2-phenyl-4H-3,1-benzoxazine |
| SMILES | Clc1ccc2c(c1)COC(c1ccccc1)=N2 |
| InChI | InChI=1S/C14H10ClNO/c15-12-6-7-13-11(8-12)9-17-14(16-13)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | DOSBLXFFEDBCFU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-phenyl-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-phenyl-4H-3,1-benzoxazine?
The IUPAC name of 6-chloro-2-phenyl-4H-3,1-benzoxazine (CID 102290950) is 6-chloro-2-phenyl-4H-3,1-benzoxazine.
What is the SMILES notation for 6-chloro-2-phenyl-4H-3,1-benzoxazine?
The canonical SMILES for 6-chloro-2-phenyl-4H-3,1-benzoxazine is Clc1ccc2c(c1)COC(c1ccccc1)=N2.
What is the InChIKey of 6-chloro-2-phenyl-4H-3,1-benzoxazine?
The InChIKey is DOSBLXFFEDBCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO/c15-12-6-7-13-11(8-12)9-17-14(16-13)10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of 6-chloro-2-phenyl-4H-3,1-benzoxazine?
6-chloro-2-phenyl-4H-3,1-benzoxazine has a molecular weight of 243.69 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-phenyl-4H-3,1-benzoxazine is sourced from PubChem (CID 102290950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).