C44H30N4O4 — CID 102290994
2-(9-ethylcarbazol-3-yl)-5-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 102290994) has the molecular formula C44H30N4O4 and a molecular weight of 678.75 g/mol. Its IUPAC name is 2-(9-ethylcarbazol-3-yl)-5-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-(9-ethylcarbazol-3-yl)-5-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102290994 |
| Molecular Formula | C44H30N4O4 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 2-(9-ethylcarbazol-3-yl)-5-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCn1c2ccccc2c2cc(N3C(=O)c4ccc(-c5ccc6c(c5)C(=O)N(c5ccc7c(c5)c5ccccc5n7CC)C6=O)cc4C3=O)ccc21 |
| InChI | InChI=1S/C44H30N4O4/c1-3-45-37-11-7-5-9-29(37)33-23-27(15-19-39(33)45)47-41(49)31-17-13-25(21-35(31)43(47)51)26-14-18-32-36(22-26)44(52)48(42(32)50)28-16-20-40-34(24-28)30-10-6-8-12-38(30)46(40)4-2/h5-24H,3-4H2,1-2H3 |
| InChIKey | IMHMJVJYITYHPT-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|