About methyl non-1-en-3-yl carbonate
methyl non-1-en-3-yl carbonate (PubChem CID 102291111) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl non-1-en-3-yl carbonate.
Molecular Properties
| Compound Name | methyl non-1-en-3-yl carbonate |
| PubChem CID | 102291111 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | methyl non-1-en-3-yl carbonate |
| SMILES | C=CC(CCCCCC)OC(=O)OC |
| InChI | InChI=1S/C11H20O3/c1-4-6-7-8-9-10(5-2)14-11(12)13-3/h5,10H,2,4,6-9H2,1,3H3 |
| InChIKey | ICZBOWQEJFPGSW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl non-1-en-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl non-1-en-3-yl carbonate?
The IUPAC name of methyl non-1-en-3-yl carbonate (CID 102291111) is methyl non-1-en-3-yl carbonate.
What is the SMILES notation for methyl non-1-en-3-yl carbonate?
The canonical SMILES for methyl non-1-en-3-yl carbonate is C=CC(CCCCCC)OC(=O)OC.
What is the InChIKey of methyl non-1-en-3-yl carbonate?
The InChIKey is ICZBOWQEJFPGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-4-6-7-8-9-10(5-2)14-11(12)13-3/h5,10H,2,4,6-9H2,1,3H3.
What are the key properties of methyl non-1-en-3-yl carbonate?
methyl non-1-en-3-yl carbonate has a molecular weight of 200.28 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl non-1-en-3-yl carbonate is sourced from PubChem (CID 102291111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).