C24H22N2O3 — CID 102291119
7-(4-methylphenyl)-5-(2,3,4-trimethoxyphenyl)-1,6-naphthyridine (PubChem CID 102291119) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 7-(4-methylphenyl)-5-(2,3,4-trimethoxyphenyl)-1,6-naphthyridine.
| Compound Name | 7-(4-methylphenyl)-5-(2,3,4-trimethoxyphenyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 102291119 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 7-(4-methylphenyl)-5-(2,3,4-trimethoxyphenyl)-1,6-naphthyridine |
| SMILES | COc1ccc(-c2nc(-c3ccc(C)cc3)cc3ncccc23)c(OC)c1OC |
| InChI | InChI=1S/C24H22N2O3/c1-15-7-9-16(10-8-15)19-14-20-17(6-5-13-25-20)22(26-19)18-11-12-21(27-2)24(29-4)23(18)28-3/h5-14H,1-4H3 |
| InChIKey | HAFHIQXOTCASFY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |