About (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one
(1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one (PubChem CID 102291257) has the molecular formula C25H19NO
and a molecular weight of 349.43 g/mol. Its IUPAC name is (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one.
Molecular Properties
| Compound Name | (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one |
| PubChem CID | 102291257 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one |
| SMILES | Cc1ccc(C2=N[C@@]3(C=CC(=O)c4ccccc43)c3c(C)cccc32)cc1 |
| InChI | InChI=1S/C25H19NO/c1-16-10-12-18(13-11-16)24-20-8-5-6-17(2)23(20)25(26-24)15-14-22(27)19-7-3-4-9-21(19)25/h3-15H,1-2H3/t25-/m1/s1 |
| InChIKey | MKSPTQRHQFVPHS-RUZDIDTESA-N |
| XLogP | 5.15 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one?
The IUPAC name of (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one (CID 102291257) is (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one.
What is the SMILES notation for (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one?
The canonical SMILES for (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one is Cc1ccc(C2=N[C@@]3(C=CC(=O)c4ccccc43)c3c(C)cccc32)cc1.
What is the InChIKey of (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one?
The InChIKey is MKSPTQRHQFVPHS-RUZDIDTESA-N. The full InChI is InChI=1S/C25H19NO/c1-16-10-12-18(13-11-16)24-20-8-5-6-17(2)23(20)25(26-24)15-14-22(27)19-7-3-4-9-21(19)25/h3-15H,1-2H3/t25-/m1/s1.
What are the key properties of (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one?
(1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one has a molecular weight of 349.43 g/mol, XLogP of 5.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-7-methyl-3-(4-methylphenyl)spiro[isoindole-1,4'-naphthalene]-1'-one is sourced from PubChem (CID 102291257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).